C16H15N3O4S — CID 110785059
N-[4-(1,3-benzoxazol-6-ylmethylsulfamoyl)phenyl]acetamide (PubChem CID 110785059) has the molecular formula C16H15N3O4S and a molecular weight of 345.38 g/mol. Its IUPAC name is N-[4-(1,3-benzoxazol-6-ylmethylsulfamoyl)phenyl]acetamide.
| Compound Name | N-[4-(1,3-benzoxazol-6-ylmethylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 110785059 |
| Molecular Formula | C16H15N3O4S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | N-[4-(1,3-benzoxazol-6-ylmethylsulfamoyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NCc2ccc3ncoc3c2)cc1 |
| InChI | InChI=1S/C16H15N3O4S/c1-11(20)19-13-3-5-14(6-4-13)24(21,22)18-9-12-2-7-15-16(8-12)23-10-17-15/h2-8,10,18H,9H2,1H3,(H,19,20) |
| InChIKey | DCLBPXICLMKULJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |