C9H10N2O3S2 — CID 110722045
N-[2-(1,3-oxazol-4-yl)ethyl]thiophene-2-sulfonamide (PubChem CID 110722045) has the molecular formula C9H10N2O3S2 and a molecular weight of 258.32 g/mol. Its IUPAC name is N-[2-(1,3-oxazol-4-yl)ethyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-(1,3-oxazol-4-yl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110722045 |
| Molecular Formula | C9H10N2O3S2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.01 |
| IUPAC Name | N-[2-(1,3-oxazol-4-yl)ethyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCCc1cocn1)c1cccs1 |
| InChI | InChI=1S/C9H10N2O3S2/c12-16(13,9-2-1-5-15-9)11-4-3-8-6-14-7-10-8/h1-2,5-7,11H,3-4H2 |
| InChIKey | RRMWNDQIUYKGRX-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |