C10H12N2O3S2 — CID 110722046
5-methyl-N-[2-(1,3-oxazol-4-yl)ethyl]thiophene-2-sulfonamide (PubChem CID 110722046) has the molecular formula C10H12N2O3S2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 5-methyl-N-[2-(1,3-oxazol-4-yl)ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-methyl-N-[2-(1,3-oxazol-4-yl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110722046 |
| Molecular Formula | C10H12N2O3S2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | 5-methyl-N-[2-(1,3-oxazol-4-yl)ethyl]thiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCc2cocn2)s1 |
| InChI | InChI=1S/C10H12N2O3S2/c1-8-2-3-10(16-8)17(13,14)12-5-4-9-6-15-7-11-9/h2-3,6-7,12H,4-5H2,1H3 |
| InChIKey | WVCZNRANOOQTCV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |