C8H14N2O4S3 — CID 61132568
5-methyl-N-(3-sulfamoylpropyl)thiophene-2-sulfonamide (PubChem CID 61132568) has the molecular formula C8H14N2O4S3 and a molecular weight of 298.41 g/mol. Its IUPAC name is 5-methyl-N-(3-sulfamoylpropyl)thiophene-2-sulfonamide.
| Compound Name | 5-methyl-N-(3-sulfamoylpropyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 61132568 |
| Molecular Formula | C8H14N2O4S3 |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 5-methyl-N-(3-sulfamoylpropyl)thiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCCS(N)(=O)=O)s1 |
| InChI | InChI=1S/C8H14N2O4S3/c1-7-3-4-8(15-7)17(13,14)10-5-2-6-16(9,11)12/h3-4,10H,2,5-6H2,1H3,(H2,9,11,12) |
| InChIKey | IBQGEXFIKLHHAB-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|