C9H14N2O3S2 — CID 47337072
5-methyl-N-(3-sulfamoylpropyl)thiophene-2-carboxamide (PubChem CID 47337072) has the molecular formula C9H14N2O3S2 and a molecular weight of 262.36 g/mol. Its IUPAC name is 5-methyl-N-(3-sulfamoylpropyl)thiophene-2-carboxamide.
| Compound Name | 5-methyl-N-(3-sulfamoylpropyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 47337072 |
| Molecular Formula | C9H14N2O3S2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 5-methyl-N-(3-sulfamoylpropyl)thiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NCCCS(N)(=O)=O)s1 |
| InChI | InChI=1S/C9H14N2O3S2/c1-7-3-4-8(15-7)9(12)11-5-2-6-16(10,13)14/h3-4H,2,5-6H2,1H3,(H,11,12)(H2,10,13,14) |
| InChIKey | QBXRPZGZQFHWTE-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|