About N-butyl-5-methylthiophene-2-carboxamide;penta-1,4-diene
N-butyl-5-methylthiophene-2-carboxamide;penta-1,4-diene (PubChem CID 143748403) has the molecular formula C15H23NOS
and a molecular weight of 265.42 g/mol. Its IUPAC name is N-butyl-5-methylthiophene-2-carboxamide;penta-1,4-diene.
Molecular Properties
| Compound Name | N-butyl-5-methylthiophene-2-carboxamide;penta-1,4-diene |
| PubChem CID | 143748403 |
| Molecular Formula | C15H23NOS |
| Molecular Weight | 265.42 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | N-butyl-5-methylthiophene-2-carboxamide;penta-1,4-diene |
| SMILES | C=CCC=C.CCCCNC(=O)c1ccc(C)s1 |
| InChI | InChI=1S/C10H15NOS.C5H8/c1-3-4-7-11-10(12)9-6-5-8(2)13-9;1-3-5-4-2/h5-6H,3-4,7H2,1-2H3,(H,11,12);3-4H,1-2,5H2 |
| InChIKey | SELMBHHWKWHJLB-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-5-methylthiophene-2-carboxamide;penta-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-5-methylthiophene-2-carboxamide;penta-1,4-diene?
The IUPAC name of N-butyl-5-methylthiophene-2-carboxamide;penta-1,4-diene (CID 143748403) is N-butyl-5-methylthiophene-2-carboxamide;penta-1,4-diene.
What is the SMILES notation for N-butyl-5-methylthiophene-2-carboxamide;penta-1,4-diene?
The canonical SMILES for N-butyl-5-methylthiophene-2-carboxamide;penta-1,4-diene is C=CCC=C.CCCCNC(=O)c1ccc(C)s1.
What is the InChIKey of N-butyl-5-methylthiophene-2-carboxamide;penta-1,4-diene?
The InChIKey is SELMBHHWKWHJLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NOS.C5H8/c1-3-4-7-11-10(12)9-6-5-8(2)13-9;1-3-5-4-2/h5-6H,3-4,7H2,1-2H3,(H,11,12);3-4H,1-2,5H2.
What are the key properties of N-butyl-5-methylthiophene-2-carboxamide;penta-1,4-diene?
N-butyl-5-methylthiophene-2-carboxamide;penta-1,4-diene has a molecular weight of 265.42 g/mol, XLogP of 4.33, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-5-methylthiophene-2-carboxamide;penta-1,4-diene is sourced from PubChem (CID 143748403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).