C12H19NOS — CID 115612504
N-(2-ethylbutyl)-5-methylthiophene-2-carboxamide (PubChem CID 115612504) has the molecular formula C12H19NOS and a molecular weight of 225.36 g/mol. Its IUPAC name is N-(2-ethylbutyl)-5-methylthiophene-2-carboxamide.
| Compound Name | N-(2-ethylbutyl)-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 115612504 |
| Molecular Formula | C12H19NOS |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | N-(2-ethylbutyl)-5-methylthiophene-2-carboxamide |
| SMILES | CCC(CC)CNC(=O)c1ccc(C)s1 |
| InChI | InChI=1S/C12H19NOS/c1-4-10(5-2)8-13-12(14)11-7-6-9(3)15-11/h6-7,10H,4-5,8H2,1-3H3,(H,13,14) |
| InChIKey | SOZZOWCJIWQVRV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |