C8H10FNOS — CID 130710625
N-(2-fluoroethyl)-5-methylthiophene-2-carboxamide (PubChem CID 130710625) has the molecular formula C8H10FNOS and a molecular weight of 187.24 g/mol. Its IUPAC name is N-(2-fluoroethyl)-5-methylthiophene-2-carboxamide.
| Compound Name | N-(2-fluoroethyl)-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 130710625 |
| Molecular Formula | C8H10FNOS |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | N-(2-fluoroethyl)-5-methylthiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NCCF)s1 |
| InChI | InChI=1S/C8H10FNOS/c1-6-2-3-7(12-6)8(11)10-5-4-9/h2-3H,4-5H2,1H3,(H,10,11) |
| InChIKey | CDENYAHOWHBKNC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |