C9H13NO3S — CID 66176220
N-(2,3-dihydroxypropyl)-5-methylthiophene-2-carboxamide (PubChem CID 66176220) has the molecular formula C9H13NO3S and a molecular weight of 215.27 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-5-methylthiophene-2-carboxamide.
| Compound Name | N-(2,3-dihydroxypropyl)-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 66176220 |
| Molecular Formula | C9H13NO3S |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-5-methylthiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NCC(O)CO)s1 |
| InChI | InChI=1S/C9H13NO3S/c1-6-2-3-8(14-6)9(13)10-4-7(12)5-11/h2-3,7,11-12H,4-5H2,1H3,(H,10,13) |
| InChIKey | JHEQYMDHVMJQPF-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |