C11H16N2O3S — CID 79031640
N-[2-[[(2R)-1-hydroxypropan-2-yl]amino]-2-oxoethyl]-5-methylthiophene-2-carboxamide (PubChem CID 79031640) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is N-[2-[[(2R)-1-hydroxypropan-2-yl]amino]-2-oxoethyl]-5-methylthiophene-2-carboxamide.
| Compound Name | N-[2-[[(2R)-1-hydroxypropan-2-yl]amino]-2-oxoethyl]-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 79031640 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | N-[2-[[(2R)-1-hydroxypropan-2-yl]amino]-2-oxoethyl]-5-methylthiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NCC(=O)N[C@H](C)CO)s1 |
| InChI | InChI=1S/C11H16N2O3S/c1-7(6-14)13-10(15)5-12-11(16)9-4-3-8(2)17-9/h3-4,7,14H,5-6H2,1-2H3,(H,12,16)(H,13,15)/t7-/m1/s1 |
| InChIKey | MBVHILSJFFTPOF-SSDOTTSWSA-N |
| XLogP | 0.28 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |