C16H17ClN2O2S — CID 26004667
N-[2-[[(1R)-1-(2-chlorophenyl)ethyl]amino]-2-oxoethyl]-5-methylthiophene-2-carboxamide (PubChem CID 26004667) has the molecular formula C16H17ClN2O2S and a molecular weight of 336.84 g/mol. Its IUPAC name is N-[2-[[(1R)-1-(2-chlorophenyl)ethyl]amino]-2-oxoethyl]-5-methylthiophene-2-carboxamide.
| Compound Name | N-[2-[[(1R)-1-(2-chlorophenyl)ethyl]amino]-2-oxoethyl]-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 26004667 |
| Molecular Formula | C16H17ClN2O2S |
| Molecular Weight | 336.84 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | N-[2-[[(1R)-1-(2-chlorophenyl)ethyl]amino]-2-oxoethyl]-5-methylthiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NCC(=O)N[C@H](C)c2ccccc2Cl)s1 |
| InChI | InChI=1S/C16H17ClN2O2S/c1-10-7-8-14(22-10)16(21)18-9-15(20)19-11(2)12-5-3-4-6-13(12)17/h3-8,11H,9H2,1-2H3,(H,18,21)(H,19,20)/t11-/m1/s1 |
| InChIKey | HPMGHAIZTCLLNF-LLVKDONJSA-N |
| XLogP | 3.32 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.84 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |