C10H13ClN2O — CID 81378449
2-amino-N-[(1S)-1-(2-chlorophenyl)ethyl]acetamide (PubChem CID 81378449) has the molecular formula C10H13ClN2O and a molecular weight of 212.68 g/mol. Its IUPAC name is 2-amino-N-[(1S)-1-(2-chlorophenyl)ethyl]acetamide.
| Compound Name | 2-amino-N-[(1S)-1-(2-chlorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 81378449 |
| Molecular Formula | C10H13ClN2O |
| Molecular Weight | 212.68 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 2-amino-N-[(1S)-1-(2-chlorophenyl)ethyl]acetamide |
| SMILES | C[C@H](NC(=O)CN)c1ccccc1Cl |
| InChI | InChI=1S/C10H13ClN2O/c1-7(13-10(14)6-12)8-4-2-3-5-9(8)11/h2-5,7H,6,12H2,1H3,(H,13,14)/t7-/m0/s1 |
| InChIKey | CEDQBCMYOQPKEO-ZETCQYMHSA-N |
| XLogP | 1.48 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.68 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |