C13H18ClN3O2 — CID 8772390
2-[[2-[[(1S)-1-(2-chlorophenyl)ethyl]amino]-2-oxoethyl]amino]-N-methylacetamide (PubChem CID 8772390) has the molecular formula C13H18ClN3O2 and a molecular weight of 283.76 g/mol. Its IUPAC name is 2-[[2-[[(1S)-1-(2-chlorophenyl)ethyl]amino]-2-oxoethyl]amino]-N-methylacetamide.
| Compound Name | 2-[[2-[[(1S)-1-(2-chlorophenyl)ethyl]amino]-2-oxoethyl]amino]-N-methylacetamide |
|---|---|
| PubChem CID | 8772390 |
| Molecular Formula | C13H18ClN3O2 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 2-[[2-[[(1S)-1-(2-chlorophenyl)ethyl]amino]-2-oxoethyl]amino]-N-methylacetamide |
| SMILES | CNC(=O)CNCC(=O)N[C@@H](C)c1ccccc1Cl |
| InChI | InChI=1S/C13H18ClN3O2/c1-9(10-5-3-4-6-11(10)14)17-13(19)8-16-7-12(18)15-2/h3-6,9,16H,7-8H2,1-2H3,(H,15,18)(H,17,19)/t9-/m0/s1 |
| InChIKey | GIHSBQILHGNERI-VIFPVBQESA-N |
| XLogP | 0.85 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |