C18H17NOS — CID 27753913
5-methyl-N-[(1R)-1-naphthalen-1-ylethyl]thiophene-2-carboxamide (PubChem CID 27753913) has the molecular formula C18H17NOS and a molecular weight of 295.41 g/mol. Its IUPAC name is 5-methyl-N-[(1R)-1-naphthalen-1-ylethyl]thiophene-2-carboxamide.
| Compound Name | 5-methyl-N-[(1R)-1-naphthalen-1-ylethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 27753913 |
| Molecular Formula | C18H17NOS |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 5-methyl-N-[(1R)-1-naphthalen-1-ylethyl]thiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)N[C@H](C)c2cccc3ccccc23)s1 |
| InChI | InChI=1S/C18H17NOS/c1-12-10-11-17(21-12)18(20)19-13(2)15-9-5-7-14-6-3-4-8-16(14)15/h3-11,13H,1-2H3,(H,19,20)/t13-/m1/s1 |
| InChIKey | ATYGFDAESRNTFB-CYBMUJFWSA-N |
| XLogP | 4.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |