C10H14O3S — CID 149121842
(4S)-4,5-dihydroxy-1-(5-methylthiophen-2-yl)pentan-1-one (PubChem CID 149121842) has the molecular formula C10H14O3S and a molecular weight of 214.29 g/mol. Its IUPAC name is (4S)-4,5-dihydroxy-1-(5-methylthiophen-2-yl)pentan-1-one.
| Compound Name | (4S)-4,5-dihydroxy-1-(5-methylthiophen-2-yl)pentan-1-one |
|---|---|
| PubChem CID | 149121842 |
| Molecular Formula | C10H14O3S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | (4S)-4,5-dihydroxy-1-(5-methylthiophen-2-yl)pentan-1-one |
| SMILES | Cc1ccc(C(=O)CC[C@H](O)CO)s1 |
| InChI | InChI=1S/C10H14O3S/c1-7-2-5-10(14-7)9(13)4-3-8(12)6-11/h2,5,8,11-12H,3-4,6H2,1H3/t8-/m0/s1 |
| InChIKey | QZRFKJYFIFVLQH-QMMMGPOBSA-N |
| XLogP | 1.37 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |