C10H14O3S — CID 115480651
3,3-dimethoxy-1-(5-methylthiophen-2-yl)propan-1-one (PubChem CID 115480651) has the molecular formula C10H14O3S and a molecular weight of 214.29 g/mol. Its IUPAC name is 3,3-dimethoxy-1-(5-methylthiophen-2-yl)propan-1-one.
| Compound Name | 3,3-dimethoxy-1-(5-methylthiophen-2-yl)propan-1-one |
|---|---|
| PubChem CID | 115480651 |
| Molecular Formula | C10H14O3S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 3,3-dimethoxy-1-(5-methylthiophen-2-yl)propan-1-one |
| SMILES | COC(CC(=O)c1ccc(C)s1)OC |
| InChI | InChI=1S/C10H14O3S/c1-7-4-5-9(14-7)8(11)6-10(12-2)13-3/h4-5,10H,6H2,1-3H3 |
| InChIKey | NUEDTFCTZPPYPC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|