C10H12F2O2S — CID 103147023
3-(2,2-difluoroethoxy)-1-(5-methylthiophen-2-yl)propan-1-one (PubChem CID 103147023) has the molecular formula C10H12F2O2S and a molecular weight of 234.27 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-1-(5-methylthiophen-2-yl)propan-1-one.
| Compound Name | 3-(2,2-difluoroethoxy)-1-(5-methylthiophen-2-yl)propan-1-one |
|---|---|
| PubChem CID | 103147023 |
| Molecular Formula | C10H12F2O2S |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-1-(5-methylthiophen-2-yl)propan-1-one |
| SMILES | Cc1ccc(C(=O)CCOCC(F)F)s1 |
| InChI | InChI=1S/C10H12F2O2S/c1-7-2-3-9(15-7)8(13)4-5-14-6-10(11)12/h2-3,10H,4-6H2,1H3 |
| InChIKey | HTFAPOSFMSZNLQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|