C9H8Br2F2O2S — CID 103206590
1-(2,5-dibromothiophen-3-yl)-3-(2,2-difluoroethoxy)propan-1-one (PubChem CID 103206590) has the molecular formula C9H8Br2F2O2S and a molecular weight of 378.03 g/mol. Its IUPAC name is 1-(2,5-dibromothiophen-3-yl)-3-(2,2-difluoroethoxy)propan-1-one.
| Compound Name | 1-(2,5-dibromothiophen-3-yl)-3-(2,2-difluoroethoxy)propan-1-one |
|---|---|
| PubChem CID | 103206590 |
| Molecular Formula | C9H8Br2F2O2S |
| Molecular Weight | 378.03 g/mol |
| Exact Mass | 375.86 |
| IUPAC Name | 1-(2,5-dibromothiophen-3-yl)-3-(2,2-difluoroethoxy)propan-1-one |
| SMILES | O=C(CCOCC(F)F)c1cc(Br)sc1Br |
| InChI | InChI=1S/C9H8Br2F2O2S/c10-7-3-5(9(11)16-7)6(14)1-2-15-4-8(12)13/h3,8H,1-2,4H2 |
| InChIKey | ZBNZEWOLFFJZQT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.03 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|