C11H9F5O2 — CID 103147247
3-(2,2-difluoroethoxy)-1-(2,3,4-trifluorophenyl)propan-1-one (PubChem CID 103147247) has the molecular formula C11H9F5O2 and a molecular weight of 268.18 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-1-(2,3,4-trifluorophenyl)propan-1-one.
| Compound Name | 3-(2,2-difluoroethoxy)-1-(2,3,4-trifluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 103147247 |
| Molecular Formula | C11H9F5O2 |
| Molecular Weight | 268.18 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-1-(2,3,4-trifluorophenyl)propan-1-one |
| SMILES | O=C(CCOCC(F)F)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C11H9F5O2/c12-7-2-1-6(10(15)11(7)16)8(17)3-4-18-5-9(13)14/h1-2,9H,3-5H2 |
| InChIKey | PTGNSIRJTUWFMZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.18 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|