C11H11F3O2 — CID 65092549
4-methoxy-1-(2,3,4-trifluorophenyl)butan-1-one (PubChem CID 65092549) has the molecular formula C11H11F3O2 and a molecular weight of 232.20 g/mol. Its IUPAC name is 4-methoxy-1-(2,3,4-trifluorophenyl)butan-1-one.
| Compound Name | 4-methoxy-1-(2,3,4-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 65092549 |
| Molecular Formula | C11H11F3O2 |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 4-methoxy-1-(2,3,4-trifluorophenyl)butan-1-one |
| SMILES | COCCCC(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C11H11F3O2/c1-16-6-2-3-9(15)7-4-5-8(12)11(14)10(7)13/h4-5H,2-3,6H2,1H3 |
| InChIKey | CPBTVPVMSIJJTE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|