C10H9F3O2 — CID 106677471
4-hydroxy-1-(2,3,4-trifluorophenyl)butan-1-one (PubChem CID 106677471) has the molecular formula C10H9F3O2 and a molecular weight of 218.17 g/mol. Its IUPAC name is 4-hydroxy-1-(2,3,4-trifluorophenyl)butan-1-one.
| Compound Name | 4-hydroxy-1-(2,3,4-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 106677471 |
| Molecular Formula | C10H9F3O2 |
| Molecular Weight | 218.17 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 4-hydroxy-1-(2,3,4-trifluorophenyl)butan-1-one |
| SMILES | O=C(CCCO)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C10H9F3O2/c11-7-4-3-6(9(12)10(7)13)8(15)2-1-5-14/h3-4,14H,1-2,5H2 |
| InChIKey | ITFPQQZTHLWRBM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.17 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|