C14H12Br2O3S — CID 43798615
1-(2,5-dibromothiophen-3-yl)-2-(2-phenoxyethoxy)ethanone (PubChem CID 43798615) has the molecular formula C14H12Br2O3S and a molecular weight of 420.12 g/mol. Its IUPAC name is 1-(2,5-dibromothiophen-3-yl)-2-(2-phenoxyethoxy)ethanone.
| Compound Name | 1-(2,5-dibromothiophen-3-yl)-2-(2-phenoxyethoxy)ethanone |
|---|---|
| PubChem CID | 43798615 |
| Molecular Formula | C14H12Br2O3S |
| Molecular Weight | 420.12 g/mol |
| Exact Mass | 417.89 |
| IUPAC Name | 1-(2,5-dibromothiophen-3-yl)-2-(2-phenoxyethoxy)ethanone |
| SMILES | O=C(COCCOc1ccccc1)c1cc(Br)sc1Br |
| InChI | InChI=1S/C14H12Br2O3S/c15-13-8-11(14(16)20-13)12(17)9-18-6-7-19-10-4-2-1-3-5-10/h1-5,8H,6-7,9H2 |
| InChIKey | FHAXHGJVGXGCRB-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.12 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|