C14H12Br2O2S — CID 63491827
(2,5-dibromothiophen-3-yl)-(3-propoxyphenyl)methanone (PubChem CID 63491827) has the molecular formula C14H12Br2O2S and a molecular weight of 404.12 g/mol. Its IUPAC name is (2,5-dibromothiophen-3-yl)-(3-propoxyphenyl)methanone.
| Compound Name | (2,5-dibromothiophen-3-yl)-(3-propoxyphenyl)methanone |
|---|---|
| PubChem CID | 63491827 |
| Molecular Formula | C14H12Br2O2S |
| Molecular Weight | 404.12 g/mol |
| Exact Mass | 401.89 |
| IUPAC Name | (2,5-dibromothiophen-3-yl)-(3-propoxyphenyl)methanone |
| SMILES | CCCOc1cccc(C(=O)c2cc(Br)sc2Br)c1 |
| InChI | InChI=1S/C14H12Br2O2S/c1-2-6-18-10-5-3-4-9(7-10)13(17)11-8-12(15)19-14(11)16/h3-5,7-8H,2,6H2,1H3 |
| InChIKey | XALYCXJMAMQCAG-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.12 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |