C12H7Br2FO2S — CID 43220054
1-(2,5-dibromothiophen-3-yl)-2-(3-fluorophenoxy)ethanone (PubChem CID 43220054) has the molecular formula C12H7Br2FO2S and a molecular weight of 394.06 g/mol. Its IUPAC name is 1-(2,5-dibromothiophen-3-yl)-2-(3-fluorophenoxy)ethanone.
| Compound Name | 1-(2,5-dibromothiophen-3-yl)-2-(3-fluorophenoxy)ethanone |
|---|---|
| PubChem CID | 43220054 |
| Molecular Formula | C12H7Br2FO2S |
| Molecular Weight | 394.06 g/mol |
| Exact Mass | 391.85 |
| IUPAC Name | 1-(2,5-dibromothiophen-3-yl)-2-(3-fluorophenoxy)ethanone |
| SMILES | O=C(COc1cccc(F)c1)c1cc(Br)sc1Br |
| InChI | InChI=1S/C12H7Br2FO2S/c13-11-5-9(12(14)18-11)10(16)6-17-8-3-1-2-7(15)4-8/h1-5H,6H2 |
| InChIKey | IMBSZLBCEGBYBR-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.06 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |