C12H6Br3NO4S — CID 81496873
2-(2-bromo-6-nitrophenoxy)-1-(2,5-dibromothiophen-3-yl)ethanone (PubChem CID 81496873) has the molecular formula C12H6Br3NO4S and a molecular weight of 499.96 g/mol. Its IUPAC name is 2-(2-bromo-6-nitrophenoxy)-1-(2,5-dibromothiophen-3-yl)ethanone.
| Compound Name | 2-(2-bromo-6-nitrophenoxy)-1-(2,5-dibromothiophen-3-yl)ethanone |
|---|---|
| PubChem CID | 81496873 |
| Molecular Formula | C12H6Br3NO4S |
| Molecular Weight | 499.96 g/mol |
| Exact Mass | 496.76 |
| IUPAC Name | 2-(2-bromo-6-nitrophenoxy)-1-(2,5-dibromothiophen-3-yl)ethanone |
| SMILES | O=C(COc1c(Br)cccc1[N+](=O)[O-])c1cc(Br)sc1Br |
| InChI | InChI=1S/C12H6Br3NO4S/c13-7-2-1-3-8(16(18)19)11(7)20-5-9(17)6-4-10(14)21-12(6)15/h1-4H,5H2 |
| InChIKey | BVKKVXGJPJOMMA-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.96 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|