C9H11BrF2N2O2 — CID 103147319
1-(4-bromo-1-methylpyrazol-5-yl)-3-(2,2-difluoroethoxy)propan-1-one (PubChem CID 103147319) has the molecular formula C9H11BrF2N2O2 and a molecular weight of 297.10 g/mol. Its IUPAC name is 1-(4-bromo-1-methylpyrazol-5-yl)-3-(2,2-difluoroethoxy)propan-1-one.
| Compound Name | 1-(4-bromo-1-methylpyrazol-5-yl)-3-(2,2-difluoroethoxy)propan-1-one |
|---|---|
| PubChem CID | 103147319 |
| Molecular Formula | C9H11BrF2N2O2 |
| Molecular Weight | 297.10 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | 1-(4-bromo-1-methylpyrazol-5-yl)-3-(2,2-difluoroethoxy)propan-1-one |
| SMILES | Cn1ncc(Br)c1C(=O)CCOCC(F)F |
| InChI | InChI=1S/C9H11BrF2N2O2/c1-14-9(6(10)4-13-14)7(15)2-3-16-5-8(11)12/h4,8H,2-3,5H2,1H3 |
| InChIKey | LAFVKQYDVBHAST-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.10 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|