C10H15F2N3O2 — CID 103147118
3-(2,2-difluoroethoxy)-1-(3-propyltriazol-4-yl)propan-1-one (PubChem CID 103147118) has the molecular formula C10H15F2N3O2 and a molecular weight of 247.24 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-1-(3-propyltriazol-4-yl)propan-1-one.
| Compound Name | 3-(2,2-difluoroethoxy)-1-(3-propyltriazol-4-yl)propan-1-one |
|---|---|
| PubChem CID | 103147118 |
| Molecular Formula | C10H15F2N3O2 |
| Molecular Weight | 247.24 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-1-(3-propyltriazol-4-yl)propan-1-one |
| SMILES | CCCn1nncc1C(=O)CCOCC(F)F |
| InChI | InChI=1S/C10H15F2N3O2/c1-2-4-15-8(6-13-14-15)9(16)3-5-17-7-10(11)12/h6,10H,2-5,7H2,1H3 |
| InChIKey | XQOVSDWZJJNFMU-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.24 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|