C12H10F3N3O — CID 114685686
(3-propyltriazol-4-yl)-(3,4,5-trifluorophenyl)methanone (PubChem CID 114685686) has the molecular formula C12H10F3N3O and a molecular weight of 269.23 g/mol. Its IUPAC name is (3-propyltriazol-4-yl)-(3,4,5-trifluorophenyl)methanone.
| Compound Name | (3-propyltriazol-4-yl)-(3,4,5-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 114685686 |
| Molecular Formula | C12H10F3N3O |
| Molecular Weight | 269.23 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | (3-propyltriazol-4-yl)-(3,4,5-trifluorophenyl)methanone |
| SMILES | CCCn1nncc1C(=O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C12H10F3N3O/c1-2-3-18-10(6-16-17-18)12(19)7-4-8(13)11(15)9(14)5-7/h4-6H,2-3H2,1H3 |
| InChIKey | KADWRLAGXKZUGK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.23 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|