C9H10N4OS — CID 114686087
(3-propyltriazol-4-yl)-(1,3-thiazol-5-yl)methanone (PubChem CID 114686087) has the molecular formula C9H10N4OS and a molecular weight of 222.27 g/mol. Its IUPAC name is (3-propyltriazol-4-yl)-(1,3-thiazol-5-yl)methanone.
| Compound Name | (3-propyltriazol-4-yl)-(1,3-thiazol-5-yl)methanone |
|---|---|
| PubChem CID | 114686087 |
| Molecular Formula | C9H10N4OS |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | (3-propyltriazol-4-yl)-(1,3-thiazol-5-yl)methanone |
| SMILES | CCCn1nncc1C(=O)c1cncs1 |
| InChI | InChI=1S/C9H10N4OS/c1-2-3-13-7(4-11-12-13)9(14)8-5-10-6-15-8/h4-6H,2-3H2,1H3 |
| InChIKey | PZHKUABRUGOAMY-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |