C15H20F2O4 — CID 103147081
1-(3,4-diethoxyphenyl)-3-(2,2-difluoroethoxy)propan-1-one (PubChem CID 103147081) has the molecular formula C15H20F2O4 and a molecular weight of 302.32 g/mol. Its IUPAC name is 1-(3,4-diethoxyphenyl)-3-(2,2-difluoroethoxy)propan-1-one.
| Compound Name | 1-(3,4-diethoxyphenyl)-3-(2,2-difluoroethoxy)propan-1-one |
|---|---|
| PubChem CID | 103147081 |
| Molecular Formula | C15H20F2O4 |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 1-(3,4-diethoxyphenyl)-3-(2,2-difluoroethoxy)propan-1-one |
| SMILES | CCOc1ccc(C(=O)CCOCC(F)F)cc1OCC |
| InChI | InChI=1S/C15H20F2O4/c1-3-20-13-6-5-11(9-14(13)21-4-2)12(18)7-8-19-10-15(16)17/h5-6,9,15H,3-4,7-8,10H2,1-2H3 |
| InChIKey | IUGGUDAVIFNARI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|