C13H17F2NO4S — CID 103206500
N-[4-[3-(2,2-difluoroethoxy)propanoyl]phenyl]ethanesulfonamide (PubChem CID 103206500) has the molecular formula C13H17F2NO4S and a molecular weight of 321.35 g/mol. Its IUPAC name is N-[4-[3-(2,2-difluoroethoxy)propanoyl]phenyl]ethanesulfonamide.
| Compound Name | N-[4-[3-(2,2-difluoroethoxy)propanoyl]phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 103206500 |
| Molecular Formula | C13H17F2NO4S |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | N-[4-[3-(2,2-difluoroethoxy)propanoyl]phenyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1ccc(C(=O)CCOCC(F)F)cc1 |
| InChI | InChI=1S/C13H17F2NO4S/c1-2-21(18,19)16-11-5-3-10(4-6-11)12(17)7-8-20-9-13(14)15/h3-6,13,16H,2,7-9H2,1H3 |
| InChIKey | NREAVRDTCIDJDX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|