C16H25NO3S — CID 63834820
N-[4-(3,4,4-trimethylpentanoyl)phenyl]ethanesulfonamide (PubChem CID 63834820) has the molecular formula C16H25NO3S and a molecular weight of 311.45 g/mol. Its IUPAC name is N-[4-(3,4,4-trimethylpentanoyl)phenyl]ethanesulfonamide.
| Compound Name | N-[4-(3,4,4-trimethylpentanoyl)phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 63834820 |
| Molecular Formula | C16H25NO3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | N-[4-(3,4,4-trimethylpentanoyl)phenyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1ccc(C(=O)CC(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H25NO3S/c1-6-21(19,20)17-14-9-7-13(8-10-14)15(18)11-12(2)16(3,4)5/h7-10,12,17H,6,11H2,1-5H3 |
| InChIKey | HSMOZVOZSIZEKB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |