C12H13F3O2 — CID 103147239
3-(2,2-difluoroethoxy)-1-(3-fluoro-5-methylphenyl)propan-1-one (PubChem CID 103147239) has the molecular formula C12H13F3O2 and a molecular weight of 246.23 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-1-(3-fluoro-5-methylphenyl)propan-1-one.
| Compound Name | 3-(2,2-difluoroethoxy)-1-(3-fluoro-5-methylphenyl)propan-1-one |
|---|---|
| PubChem CID | 103147239 |
| Molecular Formula | C12H13F3O2 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-1-(3-fluoro-5-methylphenyl)propan-1-one |
| SMILES | Cc1cc(F)cc(C(=O)CCOCC(F)F)c1 |
| InChI | InChI=1S/C12H13F3O2/c1-8-4-9(6-10(13)5-8)11(16)2-3-17-7-12(14)15/h4-6,12H,2-3,7H2,1H3 |
| InChIKey | FPANGERHGXQWLG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|