C14H18F2O3 — CID 106680115
3-(2,2-difluoroethoxy)-1-(2-methoxy-4,6-dimethylphenyl)propan-1-one (PubChem CID 106680115) has the molecular formula C14H18F2O3 and a molecular weight of 272.29 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-1-(2-methoxy-4,6-dimethylphenyl)propan-1-one.
| Compound Name | 3-(2,2-difluoroethoxy)-1-(2-methoxy-4,6-dimethylphenyl)propan-1-one |
|---|---|
| PubChem CID | 106680115 |
| Molecular Formula | C14H18F2O3 |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-1-(2-methoxy-4,6-dimethylphenyl)propan-1-one |
| SMILES | COc1cc(C)cc(C)c1C(=O)CCOCC(F)F |
| InChI | InChI=1S/C14H18F2O3/c1-9-6-10(2)14(12(7-9)18-3)11(17)4-5-19-8-13(15)16/h6-7,13H,4-5,8H2,1-3H3 |
| InChIKey | LYEKWGMNRJKGNH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|