C13H17FO2 — CID 106880998
3-ethoxy-1-(2-fluoro-4,6-dimethylphenyl)propan-1-one (PubChem CID 106880998) has the molecular formula C13H17FO2 and a molecular weight of 224.27 g/mol. Its IUPAC name is 3-ethoxy-1-(2-fluoro-4,6-dimethylphenyl)propan-1-one.
| Compound Name | 3-ethoxy-1-(2-fluoro-4,6-dimethylphenyl)propan-1-one |
|---|---|
| PubChem CID | 106880998 |
| Molecular Formula | C13H17FO2 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 3-ethoxy-1-(2-fluoro-4,6-dimethylphenyl)propan-1-one |
| SMILES | CCOCCC(=O)c1c(C)cc(C)cc1F |
| InChI | InChI=1S/C13H17FO2/c1-4-16-6-5-12(15)13-10(3)7-9(2)8-11(13)14/h7-8H,4-6H2,1-3H3 |
| InChIKey | UNSOLDZGRJYCRP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|