C16H22O3 — CID 43321496
5-ethoxy-1-(2,4,6-trimethylphenyl)pentane-1,3-dione (PubChem CID 43321496) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is 5-ethoxy-1-(2,4,6-trimethylphenyl)pentane-1,3-dione.
| Compound Name | 5-ethoxy-1-(2,4,6-trimethylphenyl)pentane-1,3-dione |
|---|---|
| PubChem CID | 43321496 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 5-ethoxy-1-(2,4,6-trimethylphenyl)pentane-1,3-dione |
| SMILES | CCOCCC(=O)CC(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C16H22O3/c1-5-19-7-6-14(17)10-15(18)16-12(3)8-11(2)9-13(16)4/h8-9H,5-7,10H2,1-4H3 |
| InChIKey | SXLHKCSILZGARP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|