C12H16O2 — CID 15502799
2-methoxy-1-(2,4,6-trimethylphenyl)ethanone (PubChem CID 15502799) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-methoxy-1-(2,4,6-trimethylphenyl)ethanone.
| Compound Name | 2-methoxy-1-(2,4,6-trimethylphenyl)ethanone |
|---|---|
| PubChem CID | 15502799 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 2-methoxy-1-(2,4,6-trimethylphenyl)ethanone |
| SMILES | COCC(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C12H16O2/c1-8-5-9(2)12(10(3)6-8)11(13)7-14-4/h5-6H,7H2,1-4H3 |
| InChIKey | BPCKAYGFVGQERV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |