About 2-(2-ethylbutoxy)-1-(2,4,6-trimethylphenyl)ethanone
2-(2-ethylbutoxy)-1-(2,4,6-trimethylphenyl)ethanone (PubChem CID 114208464) has the molecular formula C17H26O2
and a molecular weight of 262.39 g/mol. Its IUPAC name is 2-(2-ethylbutoxy)-1-(2,4,6-trimethylphenyl)ethanone.
Molecular Properties
| Compound Name | 2-(2-ethylbutoxy)-1-(2,4,6-trimethylphenyl)ethanone |
| PubChem CID | 114208464 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 2-(2-ethylbutoxy)-1-(2,4,6-trimethylphenyl)ethanone |
| SMILES | CCC(CC)COCC(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C17H26O2/c1-6-15(7-2)10-19-11-16(18)17-13(4)8-12(3)9-14(17)5/h8-9,15H,6-7,10-11H2,1-5H3 |
| InChIKey | DLFPUVDBWWFBGH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-ethylbutoxy)-1-(2,4,6-trimethylphenyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethylbutoxy)-1-(2,4,6-trimethylphenyl)ethanone?
The IUPAC name of 2-(2-ethylbutoxy)-1-(2,4,6-trimethylphenyl)ethanone (CID 114208464) is 2-(2-ethylbutoxy)-1-(2,4,6-trimethylphenyl)ethanone.
What is the SMILES notation for 2-(2-ethylbutoxy)-1-(2,4,6-trimethylphenyl)ethanone?
The canonical SMILES for 2-(2-ethylbutoxy)-1-(2,4,6-trimethylphenyl)ethanone is CCC(CC)COCC(=O)c1c(C)cc(C)cc1C.
What is the InChIKey of 2-(2-ethylbutoxy)-1-(2,4,6-trimethylphenyl)ethanone?
The InChIKey is DLFPUVDBWWFBGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O2/c1-6-15(7-2)10-19-11-16(18)17-13(4)8-12(3)9-14(17)5/h8-9,15H,6-7,10-11H2,1-5H3.
What are the key properties of 2-(2-ethylbutoxy)-1-(2,4,6-trimethylphenyl)ethanone?
2-(2-ethylbutoxy)-1-(2,4,6-trimethylphenyl)ethanone has a molecular weight of 262.39 g/mol, XLogP of 4.25, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethylbutoxy)-1-(2,4,6-trimethylphenyl)ethanone is sourced from PubChem (CID 114208464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).