C17H19O2P — CID 118112452
2-phenylphosphanyloxy-1-(2,4,6-trimethylphenyl)ethanone (PubChem CID 118112452) has the molecular formula C17H19O2P and a molecular weight of 286.31 g/mol. Its IUPAC name is 2-phenylphosphanyloxy-1-(2,4,6-trimethylphenyl)ethanone.
| Compound Name | 2-phenylphosphanyloxy-1-(2,4,6-trimethylphenyl)ethanone |
|---|---|
| PubChem CID | 118112452 |
| Molecular Formula | C17H19O2P |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 2-phenylphosphanyloxy-1-(2,4,6-trimethylphenyl)ethanone |
| SMILES | Cc1cc(C)c(C(=O)COPc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C17H19O2P/c1-12-9-13(2)17(14(3)10-12)16(18)11-19-20-15-7-5-4-6-8-15/h4-10,20H,11H2,1-3H3 |
| InChIKey | SCMGUKABDCHXCD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|