C18H22O — CID 90795600
ethane;phenyl-(2,4,6-trimethylphenyl)methanone (PubChem CID 90795600) has the molecular formula C18H22O and a molecular weight of 254.37 g/mol. Its IUPAC name is ethane;phenyl-(2,4,6-trimethylphenyl)methanone.
| Compound Name | ethane;phenyl-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 90795600 |
| Molecular Formula | C18H22O |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | ethane;phenyl-(2,4,6-trimethylphenyl)methanone |
| SMILES | CC.Cc1cc(C)c(C(=O)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C16H16O.C2H6/c1-11-9-12(2)15(13(3)10-11)16(17)14-7-5-4-6-8-14;1-2/h4-10H,1-3H3;1-2H3 |
| InChIKey | HFGXXGSNNLTCKH-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |