C32H32O2P+ — CID 69491265
diphenyl-bis(2,4,6-trimethylbenzoyl)phosphanium (PubChem CID 69491265) has the molecular formula C32H32O2P+ and a molecular weight of 479.58 g/mol. Its IUPAC name is diphenyl-bis(2,4,6-trimethylbenzoyl)phosphanium.
| Compound Name | diphenyl-bis(2,4,6-trimethylbenzoyl)phosphanium |
|---|---|
| PubChem CID | 69491265 |
| Molecular Formula | C32H32O2P+ |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | diphenyl-bis(2,4,6-trimethylbenzoyl)phosphanium |
| SMILES | Cc1cc(C)c(C(=O)[P+](C(=O)c2c(C)cc(C)cc2C)(c2ccccc2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C32H32O2P/c1-21-17-23(3)29(24(4)18-21)31(33)35(27-13-9-7-10-14-27,28-15-11-8-12-16-28)32(34)30-25(5)19-22(2)20-26(30)6/h7-20H,1-6H3/q+1 |
| InChIKey | LTDBIANPCDPIIH-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|