C10H14O4P+ — CID 159688001
trihydroxy-(2,4,6-trimethylbenzoyl)phosphanium (PubChem CID 159688001) has the molecular formula C10H14O4P+ and a molecular weight of 229.19 g/mol. Its IUPAC name is trihydroxy-(2,4,6-trimethylbenzoyl)phosphanium.
| Compound Name | trihydroxy-(2,4,6-trimethylbenzoyl)phosphanium |
|---|---|
| PubChem CID | 159688001 |
| Molecular Formula | C10H14O4P+ |
| Molecular Weight | 229.19 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | trihydroxy-(2,4,6-trimethylbenzoyl)phosphanium |
| SMILES | Cc1cc(C)c(C(=O)[P+](O)(O)O)c(C)c1 |
| InChI | InChI=1S/C10H14O4P/c1-6-4-7(2)9(8(3)5-6)10(11)15(12,13)14/h4-5,12-14H,1-3H3/q+1 |
| InChIKey | HZQBSIDGIQEGIF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.19 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|