C12H17NO — CID 868051
(2R)-2-amino-1-(2,4,6-trimethylphenyl)propan-1-one (PubChem CID 868051) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is (2R)-2-amino-1-(2,4,6-trimethylphenyl)propan-1-one.
| Compound Name | (2R)-2-amino-1-(2,4,6-trimethylphenyl)propan-1-one |
|---|---|
| PubChem CID | 868051 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (2R)-2-amino-1-(2,4,6-trimethylphenyl)propan-1-one |
| SMILES | Cc1cc(C)c(C(=O)[C@@H](C)N)c(C)c1 |
| InChI | InChI=1S/C12H17NO/c1-7-5-8(2)11(9(3)6-7)12(14)10(4)13/h5-6,10H,13H2,1-4H3/t10-/m1/s1 |
| InChIKey | AHMUIJUZADHYHZ-SNVBAGLBSA-N |
| XLogP | 2.14 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |