C21H26O — CID 14636852
1,2-bis(2,4,6-trimethylphenyl)propan-1-one (PubChem CID 14636852) has the molecular formula C21H26O and a molecular weight of 294.44 g/mol. Its IUPAC name is 1,2-bis(2,4,6-trimethylphenyl)propan-1-one.
| Compound Name | 1,2-bis(2,4,6-trimethylphenyl)propan-1-one |
|---|---|
| PubChem CID | 14636852 |
| Molecular Formula | C21H26O |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | 1,2-bis(2,4,6-trimethylphenyl)propan-1-one |
| SMILES | Cc1cc(C)c(C(=O)C(C)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C21H26O/c1-12-8-14(3)19(15(4)9-12)18(7)21(22)20-16(5)10-13(2)11-17(20)6/h8-11,18H,1-7H3 |
| InChIKey | YUQVRFQUHPUGCW-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |