C21H23O3P — CID 22735025
2-phosphoroso-1,3-bis(2,4,6-trimethylphenyl)propane-1,3-dione (PubChem CID 22735025) has the molecular formula C21H23O3P and a molecular weight of 354.39 g/mol. Its IUPAC name is 2-phosphoroso-1,3-bis(2,4,6-trimethylphenyl)propane-1,3-dione.
| Compound Name | 2-phosphoroso-1,3-bis(2,4,6-trimethylphenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 22735025 |
| Molecular Formula | C21H23O3P |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 2-phosphoroso-1,3-bis(2,4,6-trimethylphenyl)propane-1,3-dione |
| SMILES | Cc1cc(C)c(C(=O)C(P=O)C(=O)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C21H23O3P/c1-11-7-13(3)17(14(4)8-11)19(22)21(25-24)20(23)18-15(5)9-12(2)10-16(18)6/h7-10,21H,1-6H3 |
| InChIKey | LSTMOURRRRIIDV-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|