C17H26O — CID 174440509
2-ethyl-4-methyl-1-(2,4,6-trimethylphenyl)pentan-1-one (PubChem CID 174440509) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is 2-ethyl-4-methyl-1-(2,4,6-trimethylphenyl)pentan-1-one.
| Compound Name | 2-ethyl-4-methyl-1-(2,4,6-trimethylphenyl)pentan-1-one |
|---|---|
| PubChem CID | 174440509 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | 2-ethyl-4-methyl-1-(2,4,6-trimethylphenyl)pentan-1-one |
| SMILES | CCC(CC(C)C)C(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C17H26O/c1-7-15(8-11(2)3)17(18)16-13(5)9-12(4)10-14(16)6/h9-11,15H,7-8H2,1-6H3 |
| InChIKey | FTOXQMTXDLSMOJ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |