C19H30O4P+ — CID 160672424
oxophosphanium;propyl 4-methyl-2-(2,4,6-trimethylbenzoyl)pentanoate (PubChem CID 160672424) has the molecular formula C19H30O4P+ and a molecular weight of 353.42 g/mol. Its IUPAC name is oxophosphanium;propyl 4-methyl-2-(2,4,6-trimethylbenzoyl)pentanoate.
| Compound Name | oxophosphanium;propyl 4-methyl-2-(2,4,6-trimethylbenzoyl)pentanoate |
|---|---|
| PubChem CID | 160672424 |
| Molecular Formula | C19H30O4P+ |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | oxophosphanium;propyl 4-methyl-2-(2,4,6-trimethylbenzoyl)pentanoate |
| SMILES | CCCOC(=O)C(CC(C)C)C(=O)c1c(C)cc(C)cc1C.O=[PH2+] |
| InChI | InChI=1S/C19H28O3.H2OP/c1-7-8-22-19(21)16(9-12(2)3)18(20)17-14(5)10-13(4)11-15(17)6;1-2/h10-12,16H,7-9H2,1-6H3;2H2/q;+1 |
| InChIKey | BBHQCFOZNGVZSP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|