C21H34O4P+ — CID 158899311
3-methylbutyl 2-(2,4,6-trimethylbenzoyl)hexanoate;oxophosphanium (PubChem CID 158899311) has the molecular formula C21H34O4P+ and a molecular weight of 381.47 g/mol. Its IUPAC name is 3-methylbutyl 2-(2,4,6-trimethylbenzoyl)hexanoate;oxophosphanium.
| Compound Name | 3-methylbutyl 2-(2,4,6-trimethylbenzoyl)hexanoate;oxophosphanium |
|---|---|
| PubChem CID | 158899311 |
| Molecular Formula | C21H34O4P+ |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 3-methylbutyl 2-(2,4,6-trimethylbenzoyl)hexanoate;oxophosphanium |
| SMILES | CCCCC(C(=O)OCCC(C)C)C(=O)c1c(C)cc(C)cc1C.O=[PH2+] |
| InChI | InChI=1S/C21H32O3.H2OP/c1-7-8-9-18(21(23)24-11-10-14(2)3)20(22)19-16(5)12-15(4)13-17(19)6;1-2/h12-14,18H,7-11H2,1-6H3;2H2/q;+1 |
| InChIKey | NFTPYHPUSFCKJF-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|