C24H38O3 — CID 87923398
octyl 2-(2,4,6-trimethylbenzoyl)hexanoate (PubChem CID 87923398) has the molecular formula C24H38O3 and a molecular weight of 374.57 g/mol. Its IUPAC name is octyl 2-(2,4,6-trimethylbenzoyl)hexanoate.
| Compound Name | octyl 2-(2,4,6-trimethylbenzoyl)hexanoate |
|---|---|
| PubChem CID | 87923398 |
| Molecular Formula | C24H38O3 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | octyl 2-(2,4,6-trimethylbenzoyl)hexanoate |
| SMILES | CCCCCCCCOC(=O)C(CCCC)C(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C24H38O3/c1-6-8-10-11-12-13-15-27-24(26)21(14-9-7-2)23(25)22-19(4)16-18(3)17-20(22)5/h16-17,21H,6-15H2,1-5H3 |
| InChIKey | YYNVQQWHEAAIEB-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|