C25H41O4P — CID 174399952
[3-methyl-1-oxo-1-(2,4,6-trimethylphenyl)butan-2-yl] 2-methyldecanoate;oxophosphane (PubChem CID 174399952) has the molecular formula C25H41O4P and a molecular weight of 436.57 g/mol. Its IUPAC name is [3-methyl-1-oxo-1-(2,4,6-trimethylphenyl)butan-2-yl] 2-methyldecanoate;oxophosphane.
| Compound Name | [3-methyl-1-oxo-1-(2,4,6-trimethylphenyl)butan-2-yl] 2-methyldecanoate;oxophosphane |
|---|---|
| PubChem CID | 174399952 |
| Molecular Formula | C25H41O4P |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | [3-methyl-1-oxo-1-(2,4,6-trimethylphenyl)butan-2-yl] 2-methyldecanoate;oxophosphane |
| SMILES | CCCCCCCCC(C)C(=O)OC(C(=O)c1c(C)cc(C)cc1C)C(C)C.O=P |
| InChI | InChI=1S/C25H40O3.HOP/c1-8-9-10-11-12-13-14-19(5)25(27)28-24(17(2)3)23(26)22-20(6)15-18(4)16-21(22)7;1-2/h15-17,19,24H,8-14H2,1-7H3;2H |
| InChIKey | NWRFZNTXOLLINA-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|